About 4-(4-aminophenyl)aniline;azanide;nickel(2+)
4-(4-aminophenyl)aniline;azanide;nickel(2+) (PubChem CID 87835817) has the molecular formula C12H16N4Ni
and a molecular weight of 274.98 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;azanide;nickel(2+).
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;azanide;nickel(2+) |
| PubChem CID | 87835817 |
| Molecular Formula | C12H16N4Ni |
| Molecular Weight | 274.98 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-(4-aminophenyl)aniline;azanide;nickel(2+) |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1.[NH2-].[NH2-].[Ni+2] |
| InChI | InChI=1S/C12H12N2.2H2N.Ni/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;;;/h1-8H,13-14H2;2*1H2;/q;2*-1;+2 |
| InChIKey | SONVEYHINAUXDT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;azanide;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;azanide;nickel(2+)?
The IUPAC name of 4-(4-aminophenyl)aniline;azanide;nickel(2+) (CID 87835817) is 4-(4-aminophenyl)aniline;azanide;nickel(2+).
What is the SMILES notation for 4-(4-aminophenyl)aniline;azanide;nickel(2+)?
The canonical SMILES for 4-(4-aminophenyl)aniline;azanide;nickel(2+) is Nc1ccc(-c2ccc(N)cc2)cc1.[NH2-].[NH2-].[Ni+2].
What is the InChIKey of 4-(4-aminophenyl)aniline;azanide;nickel(2+)?
The InChIKey is SONVEYHINAUXDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.2H2N.Ni/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;;;/h1-8H,13-14H2;2*1H2;/q;2*-1;+2.
What are the key properties of 4-(4-aminophenyl)aniline;azanide;nickel(2+)?
4-(4-aminophenyl)aniline;azanide;nickel(2+) has a molecular weight of 274.98 g/mol, XLogP of 3.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;azanide;nickel(2+) is sourced from PubChem (CID 87835817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).