About benzene-1,4-diamine;methane
benzene-1,4-diamine;methane (PubChem CID 158825195) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is benzene-1,4-diamine;methane.
Molecular Properties
| Compound Name | benzene-1,4-diamine;methane |
| PubChem CID | 158825195 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | benzene-1,4-diamine;methane |
| SMILES | C.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C6H8N2.CH4/c7-5-1-2-6(8)4-3-5;/h1-4H,7-8H2;1H4 |
| InChIKey | SLTFFOPQXIXCOO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diamine;methane?
The IUPAC name of benzene-1,4-diamine;methane (CID 158825195) is benzene-1,4-diamine;methane.
What is the SMILES notation for benzene-1,4-diamine;methane?
The canonical SMILES for benzene-1,4-diamine;methane is C.Nc1ccc(N)cc1.
What is the InChIKey of benzene-1,4-diamine;methane?
The InChIKey is SLTFFOPQXIXCOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.CH4/c7-5-1-2-6(8)4-3-5;/h1-4H,7-8H2;1H4.
What are the key properties of benzene-1,4-diamine;methane?
benzene-1,4-diamine;methane has a molecular weight of 124.19 g/mol, XLogP of 1.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diamine;methane is sourced from PubChem (CID 158825195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).