About (4-aminophenyl) thiohypofluorite;methane
(4-aminophenyl) thiohypofluorite;methane (PubChem CID 142188389) has the molecular formula C7H10FNS
and a molecular weight of 159.23 g/mol. Its IUPAC name is (4-aminophenyl) thiohypofluorite;methane.
Molecular Properties
| Compound Name | (4-aminophenyl) thiohypofluorite;methane |
| PubChem CID | 142188389 |
| Molecular Formula | C7H10FNS |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (4-aminophenyl) thiohypofluorite;methane |
| SMILES | C.Nc1ccc(SF)cc1 |
| InChI | InChI=1S/C6H6FNS.CH4/c7-9-6-3-1-5(8)2-4-6;/h1-4H,8H2;1H4 |
| InChIKey | SMORDAQNRCJJDN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) thiohypofluorite;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) thiohypofluorite;methane?
The IUPAC name of (4-aminophenyl) thiohypofluorite;methane (CID 142188389) is (4-aminophenyl) thiohypofluorite;methane.
What is the SMILES notation for (4-aminophenyl) thiohypofluorite;methane?
The canonical SMILES for (4-aminophenyl) thiohypofluorite;methane is C.Nc1ccc(SF)cc1.
What is the InChIKey of (4-aminophenyl) thiohypofluorite;methane?
The InChIKey is SMORDAQNRCJJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNS.CH4/c7-9-6-3-1-5(8)2-4-6;/h1-4H,8H2;1H4.
What are the key properties of (4-aminophenyl) thiohypofluorite;methane?
(4-aminophenyl) thiohypofluorite;methane has a molecular weight of 159.23 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) thiohypofluorite;methane is sourced from PubChem (CID 142188389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).