About azane;benzene-1,4-diamine;dihydrochloride
azane;benzene-1,4-diamine;dihydrochloride (PubChem CID 70409738) has the molecular formula C6H13Cl2N3
and a molecular weight of 198.10 g/mol. Its IUPAC name is azane;benzene-1,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | azane;benzene-1,4-diamine;dihydrochloride |
| PubChem CID | 70409738 |
| Molecular Formula | C6H13Cl2N3 |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | azane;benzene-1,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.N.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C6H8N2.2ClH.H3N/c7-5-1-2-6(8)4-3-5;;;/h1-4H,7-8H2;2*1H;1H3 |
| InChIKey | ZOXMBIUFCOOJSC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze azane;benzene-1,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzene-1,4-diamine;dihydrochloride?
The IUPAC name of azane;benzene-1,4-diamine;dihydrochloride (CID 70409738) is azane;benzene-1,4-diamine;dihydrochloride.
What is the SMILES notation for azane;benzene-1,4-diamine;dihydrochloride?
The canonical SMILES for azane;benzene-1,4-diamine;dihydrochloride is Cl.Cl.N.Nc1ccc(N)cc1.
What is the InChIKey of azane;benzene-1,4-diamine;dihydrochloride?
The InChIKey is ZOXMBIUFCOOJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.2ClH.H3N/c7-5-1-2-6(8)4-3-5;;;/h1-4H,7-8H2;2*1H;1H3.
What are the key properties of azane;benzene-1,4-diamine;dihydrochloride?
azane;benzene-1,4-diamine;dihydrochloride has a molecular weight of 198.10 g/mol, XLogP of 1.86, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzene-1,4-diamine;dihydrochloride is sourced from PubChem (CID 70409738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).