About 4-aminobenzenethiol
4-aminobenzenethiol (PubChem CID 159011943) has the molecular formula C12H14N2S2
and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-aminobenzenethiol.
Molecular Properties
| Compound Name | 4-aminobenzenethiol |
| PubChem CID | 159011943 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-aminobenzenethiol |
| SMILES | Nc1ccc(S)cc1.Nc1ccc(S)cc1 |
| InChI | InChI=1S/2C6H7NS/c2*7-5-1-3-6(8)4-2-5/h2*1-4,8H,7H2 |
| InChIKey | JSPGSVIGUXWPKI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenethiol?
The IUPAC name of 4-aminobenzenethiol (CID 159011943) is 4-aminobenzenethiol.
What is the SMILES notation for 4-aminobenzenethiol?
The canonical SMILES for 4-aminobenzenethiol is Nc1ccc(S)cc1.Nc1ccc(S)cc1.
What is the InChIKey of 4-aminobenzenethiol?
The InChIKey is JSPGSVIGUXWPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7NS/c2*7-5-1-3-6(8)4-2-5/h2*1-4,8H,7H2.
What are the key properties of 4-aminobenzenethiol?
4-aminobenzenethiol has a molecular weight of 250.39 g/mol, XLogP of 3.12, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenethiol is sourced from PubChem (CID 159011943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).