C14H18N2S — CID 142806771
4-N-methylbenzene-1,4-diamine;4-methylbenzenethiol (PubChem CID 142806771) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 4-N-methylbenzene-1,4-diamine;4-methylbenzenethiol.
| Compound Name | 4-N-methylbenzene-1,4-diamine;4-methylbenzenethiol |
|---|---|
| PubChem CID | 142806771 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-N-methylbenzene-1,4-diamine;4-methylbenzenethiol |
| SMILES | CNc1ccc(N)cc1.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C7H10N2.C7H8S/c1-9-7-4-2-6(8)3-5-7;1-6-2-4-7(8)5-3-6/h2-5,9H,8H2,1H3;2-5,8H,1H3 |
| InChIKey | XFFCTPSYOBODQZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|