About bis(4-aminobenzenethiol);benzene
bis(4-aminobenzenethiol);benzene (PubChem CID 159139687) has the molecular formula C18H20N2S2
and a molecular weight of 328.51 g/mol. Its IUPAC name is bis(4-aminobenzenethiol);benzene.
Molecular Properties
| Compound Name | bis(4-aminobenzenethiol);benzene |
| PubChem CID | 159139687 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | bis(4-aminobenzenethiol);benzene |
| SMILES | Nc1ccc(S)cc1.Nc1ccc(S)cc1.c1ccccc1 |
| InChI | InChI=1S/2C6H7NS.C6H6/c2*7-5-1-3-6(8)4-2-5;1-2-4-6-5-3-1/h2*1-4,8H,7H2;1-6H |
| InChIKey | AFWSJQZBTDZETP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-aminobenzenethiol);benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-aminobenzenethiol);benzene?
The IUPAC name of bis(4-aminobenzenethiol);benzene (CID 159139687) is bis(4-aminobenzenethiol);benzene.
What is the SMILES notation for bis(4-aminobenzenethiol);benzene?
The canonical SMILES for bis(4-aminobenzenethiol);benzene is Nc1ccc(S)cc1.Nc1ccc(S)cc1.c1ccccc1.
What is the InChIKey of bis(4-aminobenzenethiol);benzene?
The InChIKey is AFWSJQZBTDZETP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7NS.C6H6/c2*7-5-1-3-6(8)4-2-5;1-2-4-6-5-3-1/h2*1-4,8H,7H2;1-6H.
What are the key properties of bis(4-aminobenzenethiol);benzene?
bis(4-aminobenzenethiol);benzene has a molecular weight of 328.51 g/mol, XLogP of 4.80, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-aminobenzenethiol);benzene is sourced from PubChem (CID 159139687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).