About acetylene;4-(4-aminophenyl)aniline
acetylene;4-(4-aminophenyl)aniline (PubChem CID 18766839) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is acetylene;4-(4-aminophenyl)aniline.
Molecular Properties
| Compound Name | acetylene;4-(4-aminophenyl)aniline |
| PubChem CID | 18766839 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | acetylene;4-(4-aminophenyl)aniline |
| SMILES | C#C.Nc1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2.C2H2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2/h1-8H,13-14H2;1-2H |
| InChIKey | JYSGLCGVSBBGKE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;4-(4-aminophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;4-(4-aminophenyl)aniline?
The IUPAC name of acetylene;4-(4-aminophenyl)aniline (CID 18766839) is acetylene;4-(4-aminophenyl)aniline.
What is the SMILES notation for acetylene;4-(4-aminophenyl)aniline?
The canonical SMILES for acetylene;4-(4-aminophenyl)aniline is C#C.Nc1ccc(-c2ccc(N)cc2)cc1.
What is the InChIKey of acetylene;4-(4-aminophenyl)aniline?
The InChIKey is JYSGLCGVSBBGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C2H2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2/h1-8H,13-14H2;1-2H.
What are the key properties of acetylene;4-(4-aminophenyl)aniline?
acetylene;4-(4-aminophenyl)aniline has a molecular weight of 210.28 g/mol, XLogP of 2.77, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;4-(4-aminophenyl)aniline is sourced from PubChem (CID 18766839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).