C6H11AsN2O4 — CID 174783871
arsoric acid;benzene-1,4-diamine (PubChem CID 174783871) has the molecular formula C6H11AsN2O4 and a molecular weight of 250.09 g/mol. Its IUPAC name is arsoric acid;benzene-1,4-diamine.
| Compound Name | arsoric acid;benzene-1,4-diamine |
|---|---|
| PubChem CID | 174783871 |
| Molecular Formula | C6H11AsN2O4 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | arsoric acid;benzene-1,4-diamine |
| SMILES | Nc1ccc(N)cc1.O=[As](O)(O)O |
| InChI | InChI=1S/C6H8N2.AsH3O4/c7-5-1-2-6(8)4-3-5;2-1(3,4)5/h1-4H,7-8H2;(H3,2,3,4,5) |
| InChIKey | CPRNPNPDYIVALR-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|