About sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride
sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride (PubChem CID 173022794) has the molecular formula C12H13AsN3NaO3
and a molecular weight of 345.17 g/mol. Its IUPAC name is sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride.
Molecular Properties
| Compound Name | sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride |
| PubChem CID | 173022794 |
| Molecular Formula | C12H13AsN3NaO3 |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride |
| SMILES | Nc1ccc(/N=N/c2ccc([As](=O)(O)O)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C12H12AsN3O3.Na.H/c14-10-3-7-12(8-4-10)16-15-11-5-1-9(2-6-11)13(17,18)19;;/h1-8H,14H2,(H2,17,18,19);;/q;+1;-1/b16-15+;; |
| InChIKey | VFQAKFAUCSWTQO-VRZXRVJBSA-N |
| XLogP | -1.64 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride?
The IUPAC name of sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride (CID 173022794) is sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride.
What is the SMILES notation for sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride?
The canonical SMILES for sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride is Nc1ccc(/N=N/c2ccc([As](=O)(O)O)cc2)cc1.[H-].[Na+].
What is the InChIKey of sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride?
The InChIKey is VFQAKFAUCSWTQO-VRZXRVJBSA-N. The full InChI is InChI=1S/C12H12AsN3O3.Na.H/c14-10-3-7-12(8-4-10)16-15-11-5-1-9(2-6-11)13(17,18)19;;/h1-8H,14H2,(H2,17,18,19);;/q;+1;-1/b16-15+;;.
What are the key properties of sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride?
sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride has a molecular weight of 345.17 g/mol, XLogP of -1.64, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;[4-[(4-aminophenyl)diazenyl]phenyl]arsonic acid;hydride is sourced from PubChem (CID 173022794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).