C11H10AsN7O4 — CID 135470148
[4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)diazenyl]phenyl]arsonic acid (PubChem CID 135470148) has the molecular formula C11H10AsN7O4 and a molecular weight of 379.17 g/mol. Its IUPAC name is [4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)diazenyl]phenyl]arsonic acid.
| Compound Name | [4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)diazenyl]phenyl]arsonic acid |
|---|---|
| PubChem CID | 135470148 |
| Molecular Formula | C11H10AsN7O4 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | [4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)diazenyl]phenyl]arsonic acid |
| SMILES | Nc1nc2nc(/N=N/c3ccc([As](=O)(O)O)cc3)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H10AsN7O4/c13-10-15-8-7(9(20)17-10)14-11(16-8)19-18-6-3-1-5(2-4-6)12(21,22)23/h1-4H,(H2,21,22,23)(H4,13,14,15,16,17,20)/b19-18+ |
| InChIKey | NGFQAWGVOGIYHO-VHEBQXMUSA-N |
| XLogP | -0.80 |
| TPSA | 182.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|