C11H8ClN5OS — CID 135540455
2-amino-8-(4-chlorophenyl)sulfanyl-1,7-dihydropurin-6-one (PubChem CID 135540455) has the molecular formula C11H8ClN5OS and a molecular weight of 293.74 g/mol. Its IUPAC name is 2-amino-8-(4-chlorophenyl)sulfanyl-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(4-chlorophenyl)sulfanyl-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135540455 |
| Molecular Formula | C11H8ClN5OS |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-amino-8-(4-chlorophenyl)sulfanyl-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(Sc3ccc(Cl)cc3)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H8ClN5OS/c12-5-1-3-6(4-2-5)19-11-14-7-8(16-11)15-10(13)17-9(7)18/h1-4H,(H4,13,14,15,16,17,18) |
| InChIKey | QAZXVDQDWHZKFR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |