C19H15N5O2S — CID 135566684
2-amino-8-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-1,7-dihydropurin-6-one (PubChem CID 135566684) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is 2-amino-8-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135566684 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-amino-8-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(SCC(=O)c3ccc(-c4ccccc4)cc3)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H15N5O2S/c20-18-22-16-15(17(26)24-18)21-19(23-16)27-10-14(25)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2,(H4,20,21,22,23,24,26) |
| InChIKey | JPQMPGXXKRYOGX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |