C15H16N8O2S2 — CID 143047229
2-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanyl]-N'-[[(Z)-1-phenyl-2-sulfanylethenyl]amino]acetohydrazide (PubChem CID 143047229) has the molecular formula C15H16N8O2S2 and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanyl]-N'-[[(Z)-1-phenyl-2-sulfanylethenyl]amino]acetohydrazide.
| Compound Name | 2-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanyl]-N'-[[(Z)-1-phenyl-2-sulfanylethenyl]amino]acetohydrazide |
|---|---|
| PubChem CID | 143047229 |
| Molecular Formula | C15H16N8O2S2 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanyl]-N'-[[(Z)-1-phenyl-2-sulfanylethenyl]amino]acetohydrazide |
| SMILES | Nc1nc2nc(SCC(=O)NNN/C(=C\S)c3ccccc3)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N8O2S2/c16-14-18-12-11(13(25)20-14)17-15(19-12)27-7-10(24)22-23-21-9(6-26)8-4-2-1-3-5-8/h1-6,21,23,26H,7H2,(H,22,24)(H4,16,17,18,19,20,25)/b9-6- |
| InChIKey | WUMNDGSYWCVNIT-TWGQIWQCSA-N |
| XLogP | 0.37 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|