C12H10N6O3S — CID 137224982
2-amino-8-[(2-nitrophenyl)methylsulfanyl]-1,7-dihydropurin-6-one (PubChem CID 137224982) has the molecular formula C12H10N6O3S and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-amino-8-[(2-nitrophenyl)methylsulfanyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-[(2-nitrophenyl)methylsulfanyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 137224982 |
| Molecular Formula | C12H10N6O3S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-amino-8-[(2-nitrophenyl)methylsulfanyl]-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(SCc3ccccc3[N+](=O)[O-])[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N6O3S/c13-11-15-9-8(10(19)17-11)14-12(16-9)22-5-6-3-1-2-4-7(6)18(20)21/h1-4H,5H2,(H4,13,14,15,16,17,19) |
| InChIKey | VJHKMBXOBQUXRH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|