C13H10N6OS — CID 135468747
4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]benzonitrile (PubChem CID 135468747) has the molecular formula C13H10N6OS and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]benzonitrile.
| Compound Name | 4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 135468747 |
| Molecular Formula | C13H10N6OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[(2-amino-6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]benzonitrile |
| SMILES | N#Cc1ccc(CSc2nc3nc(N)[nH]c(=O)c3[nH]2)cc1 |
| InChI | InChI=1S/C13H10N6OS/c14-5-7-1-3-8(4-2-7)6-21-13-16-9-10(18-13)17-12(15)19-11(9)20/h1-4H,6H2,(H4,15,16,17,18,19,20) |
| InChIKey | GWZOSZRSFBULCC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |