C12H9FN4OS — CID 135509365
2-[(4-fluorophenyl)methylsulfanyl]-1,7-dihydropurin-6-one (PubChem CID 135509365) has the molecular formula C12H9FN4OS and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135509365 |
| Molecular Formula | C12H9FN4OS |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(SCc2ccc(F)cc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H9FN4OS/c13-8-3-1-7(2-4-8)5-19-12-16-10-9(11(18)17-12)14-6-15-10/h1-4,6H,5H2,(H2,14,15,16,17,18) |
| InChIKey | RUAIUVGHNUUWCI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |