C13H10N4O3S — CID 136911944
(2R)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]-2-phenylacetic acid (PubChem CID 136911944) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is (2R)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 136911944 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (2R)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]-2-phenylacetic acid |
| SMILES | O=C(O)[C@H](Sc1nc2nc[nH]c2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C13H10N4O3S/c18-11-8-10(15-6-14-8)16-13(17-11)21-9(12(19)20)7-4-2-1-3-5-7/h1-6,9H,(H,19,20)(H2,14,15,16,17,18)/t9-/m1/s1 |
| InChIKey | ATSRCWNWYPNJJH-SECBINFHSA-N |
| XLogP | 1.56 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |