C11H9N5OS — CID 135999044
2-(pyridin-4-ylmethylsulfanyl)-1,7-dihydropurin-6-one (PubChem CID 135999044) has the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethylsulfanyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-(pyridin-4-ylmethylsulfanyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135999044 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(pyridin-4-ylmethylsulfanyl)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(SCc2ccncc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H9N5OS/c17-10-8-9(14-6-13-8)15-11(16-10)18-5-7-1-3-12-4-2-7/h1-4,6H,5H2,(H2,13,14,15,16,17) |
| InChIKey | OSSFQXICNWXKQA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |