C19H15N5O3S — CID 135460148
phenyl N-[3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]phenyl]carbamate (PubChem CID 135460148) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is phenyl N-[3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]phenyl]carbamate.
| Compound Name | phenyl N-[3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 135460148 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | phenyl N-[3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanylmethyl]phenyl]carbamate |
| SMILES | O=C(Nc1cccc(CSc2nc3nc[nH]c(=O)c3[nH]2)c1)Oc1ccccc1 |
| InChI | InChI=1S/C19H15N5O3S/c25-17-15-16(20-11-21-17)24-18(23-15)28-10-12-5-4-6-13(9-12)22-19(26)27-14-7-2-1-3-8-14/h1-9,11H,10H2,(H,22,26)(H2,20,21,23,24,25) |
| InChIKey | APKQRZSAHUYZBU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |