C13H11N5O2 — CID 135734285
N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenylacetamide (PubChem CID 135734285) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenylacetamide.
| Compound Name | N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 135734285 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(6-oxo-1,7-dihydropurin-2-yl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H11N5O2/c19-9(6-8-4-2-1-3-5-8)16-13-17-11-10(12(20)18-13)14-7-15-11/h1-5,7H,6H2,(H3,14,15,16,17,18,19,20) |
| InChIKey | KTZHKRSJEYBDFG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |