C11H15N5O3 — CID 141073885
[(6-oxo-1,7-dihydropurin-2-yl)amino]methyl pentanoate (PubChem CID 141073885) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is [(6-oxo-1,7-dihydropurin-2-yl)amino]methyl pentanoate.
| Compound Name | [(6-oxo-1,7-dihydropurin-2-yl)amino]methyl pentanoate |
|---|---|
| PubChem CID | 141073885 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [(6-oxo-1,7-dihydropurin-2-yl)amino]methyl pentanoate |
| SMILES | CCCCC(=O)OCNc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O3/c1-2-3-4-7(17)19-6-14-11-15-9-8(10(18)16-11)12-5-13-9/h5H,2-4,6H2,1H3,(H3,12,13,14,15,16,18) |
| InChIKey | DLSZWPKSEKFLEX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|