C6H9Cl2N5O — CID 174295728
2-(methylamino)-1,7-dihydropurin-6-one;dihydrochloride (PubChem CID 174295728) has the molecular formula C6H9Cl2N5O and a molecular weight of 238.08 g/mol. Its IUPAC name is 2-(methylamino)-1,7-dihydropurin-6-one;dihydrochloride.
| Compound Name | 2-(methylamino)-1,7-dihydropurin-6-one;dihydrochloride |
|---|---|
| PubChem CID | 174295728 |
| Molecular Formula | C6H9Cl2N5O |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-(methylamino)-1,7-dihydropurin-6-one;dihydrochloride |
| SMILES | CNc1nc2nc[nH]c2c(=O)[nH]1.Cl.Cl |
| InChI | InChI=1S/C6H7N5O.2ClH/c1-7-6-10-4-3(5(12)11-6)8-2-9-4;;/h2H,1H3,(H3,7,8,9,10,11,12);2*1H |
| InChIKey | URAWTSLQCKBMAB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |