C5H8FN5O8P2 — CID 174593809
2-(fluoroamino)-1,7-dihydropurin-6-one;phosphono dihydrogen phosphate (PubChem CID 174593809) has the molecular formula C5H8FN5O8P2 and a molecular weight of 347.09 g/mol. Its IUPAC name is 2-(fluoroamino)-1,7-dihydropurin-6-one;phosphono dihydrogen phosphate.
| Compound Name | 2-(fluoroamino)-1,7-dihydropurin-6-one;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 174593809 |
| Molecular Formula | C5H8FN5O8P2 |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(fluoroamino)-1,7-dihydropurin-6-one;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.O=c1[nH]c(NF)nc2nc[nH]c12 |
| InChI | InChI=1S/C5H4FN5O.H4O7P2/c6-11-5-9-3-2(4(12)10-5)7-1-8-3;1-8(2,3)7-9(4,5)6/h1H,(H3,7,8,9,10,11,12);(H2,1,2,3)(H2,4,5,6) |
| InChIKey | BVTAINOVLXIWOX-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|