C6H4F3N5O — CID 141084811
2-(trifluoromethylamino)-1,7-dihydropurin-6-one (PubChem CID 141084811) has the molecular formula C6H4F3N5O and a molecular weight of 219.13 g/mol. Its IUPAC name is 2-(trifluoromethylamino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(trifluoromethylamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 141084811 |
| Molecular Formula | C6H4F3N5O |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-(trifluoromethylamino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(NC(F)(F)F)nc2nc[nH]c12 |
| InChI | InChI=1S/C6H4F3N5O/c7-6(8,9)14-5-12-3-2(4(15)13-5)10-1-11-3/h1H,(H3,10,11,12,13,14,15) |
| InChIKey | WGPNRBKJWTVHOA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|