C11H11N5O — CID 137199465
2-(cyclohexa-2,4-dien-1-ylamino)-1,7-dihydropurin-6-one (PubChem CID 137199465) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(cyclohexa-2,4-dien-1-ylamino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(cyclohexa-2,4-dien-1-ylamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 137199465 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(cyclohexa-2,4-dien-1-ylamino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(NC2C=CC=CC2)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H11N5O/c17-10-8-9(13-6-12-8)15-11(16-10)14-7-4-2-1-3-5-7/h1-4,6-7H,5H2,(H3,12,13,14,15,16,17) |
| InChIKey | CIGWOPIBIHUYOK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |