C9H11N5O2 — CID 136865373
2-(1-hydroxybut-3-en-2-ylamino)-1,7-dihydropurin-6-one (PubChem CID 136865373) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-(1-hydroxybut-3-en-2-ylamino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(1-hydroxybut-3-en-2-ylamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136865373 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-(1-hydroxybut-3-en-2-ylamino)-1,7-dihydropurin-6-one |
| SMILES | C=CC(CO)Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H11N5O2/c1-2-5(3-15)12-9-13-7-6(8(16)14-9)10-4-11-7/h2,4-5,15H,1,3H2,(H3,10,11,12,13,14,16) |
| InChIKey | QUPAMLQSODLBBY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|