C9H11N5O2 — CID 135411165
N-(6-oxo-1,7-dihydropurin-2-yl)butanamide (PubChem CID 135411165) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is N-(6-oxo-1,7-dihydropurin-2-yl)butanamide.
| Compound Name | N-(6-oxo-1,7-dihydropurin-2-yl)butanamide |
|---|---|
| PubChem CID | 135411165 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-(6-oxo-1,7-dihydropurin-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H11N5O2/c1-2-3-5(15)12-9-13-7-6(8(16)14-9)10-4-11-7/h4H,2-3H2,1H3,(H3,10,11,12,13,14,15,16) |
| InChIKey | NLQPNFQTSJQJAH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |