About 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate
2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate (PubChem CID 135748399) has the molecular formula C7H6N5O3-
and a molecular weight of 208.16 g/mol. Its IUPAC name is 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate.
Molecular Properties
| Compound Name | 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate |
| PubChem CID | 135748399 |
| Molecular Formula | C7H6N5O3- |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate |
| SMILES | O=C([O-])CNc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15)/p-1 |
| InChIKey | FAPZNNPCYDCZTA-UHFFFAOYSA-M |
| XLogP | -2.19 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate?
The IUPAC name of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate (CID 135748399) is 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate.
What is the SMILES notation for 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate?
The canonical SMILES for 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate is O=C([O-])CNc1nc2nc[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate?
The InChIKey is FAPZNNPCYDCZTA-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15)/p-1.
What are the key properties of 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate?
2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate has a molecular weight of 208.16 g/mol, XLogP of -2.19, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate is sourced from PubChem (CID 135748399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).