C7H6N5O3- — CID 135748399
2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate (PubChem CID 135748399) has the molecular formula C7H6N5O3- and a molecular weight of 208.16 g/mol. Its IUPAC name is 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate.
| Compound Name | 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 135748399 |
| Molecular Formula | C7H6N5O3- |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-[(6-oxo-1,7-dihydropurin-2-yl)amino]acetate |
| SMILES | O=C([O-])CNc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N5O3/c13-3(14)1-8-7-11-5-4(6(15)12-7)9-2-10-5/h2H,1H2,(H,13,14)(H3,8,9,10,11,12,15)/p-1 |
| InChIKey | FAPZNNPCYDCZTA-UHFFFAOYSA-M |
| XLogP | -2.19 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |