About 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid
3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid (PubChem CID 173320245) has the molecular formula C9H14N5O5P
and a molecular weight of 303.22 g/mol. Its IUPAC name is 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid.
Molecular Properties
| Compound Name | 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid |
| PubChem CID | 173320245 |
| Molecular Formula | C9H14N5O5P |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid |
| SMILES | O=c1[nH]c(NCCCOCP(=O)(O)O)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H14N5O5P/c15-8-6-7(12-4-11-6)13-9(14-8)10-2-1-3-19-5-20(16,17)18/h4H,1-3,5H2,(H2,16,17,18)(H3,10,11,12,13,14,15) |
| InChIKey | BCZIPHKUYLHTMV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid?
The IUPAC name of 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid (CID 173320245) is 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid.
What is the SMILES notation for 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid?
The canonical SMILES for 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid is O=c1[nH]c(NCCCOCP(=O)(O)O)nc2nc[nH]c12.
What is the InChIKey of 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid?
The InChIKey is BCZIPHKUYLHTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N5O5P/c15-8-6-7(12-4-11-6)13-9(14-8)10-2-1-3-19-5-20(16,17)18/h4H,1-3,5H2,(H2,16,17,18)(H3,10,11,12,13,14,15).
What are the key properties of 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid?
3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid has a molecular weight of 303.22 g/mol, XLogP of -0.40, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-oxo-1,7-dihydropurin-2-yl)amino]propoxymethylphosphonic acid is sourced from PubChem (CID 173320245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).