C11H15N5O3S — CID 135891904
N-(3-methoxypropyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetamide (PubChem CID 135891904) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135891904 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(3-methoxypropyl)-2-[(6-oxo-1,7-dihydropurin-2-yl)sulfanyl]acetamide |
| SMILES | COCCCNC(=O)CSc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O3S/c1-19-4-2-3-12-7(17)5-20-11-15-9-8(10(18)16-11)13-6-14-9/h6H,2-5H2,1H3,(H,12,17)(H2,13,14,15,16,18) |
| InChIKey | MQHPAOLZLQAGHH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|