C13H15F2N3O2S — CID 34375248
2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 34375248) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 34375248 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C13H15F2N3O2S/c1-20-4-2-3-16-12(19)7-21-13-17-10-5-8(14)9(15)6-11(10)18-13/h5-6H,2-4,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | CUUSZHTZFBLMBA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|