C20H20F2N4O2S — CID 34380316
3-[[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 34380316) has the molecular formula C20H20F2N4O2S and a molecular weight of 418.47 g/mol. Its IUPAC name is 3-[[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 34380316 |
| Molecular Formula | C20H20F2N4O2S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-[[2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CSc2nc3cc(F)c(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C20H20F2N4O2S/c1-3-26(4-2)19(28)12-6-5-7-13(8-12)23-18(27)11-29-20-24-16-9-14(21)15(22)10-17(16)25-20/h5-10H,3-4,11H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | XSTGNUUFHWELRK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_65_D(1)', 'substructure': 'N/A'} |
|---|