C17H15F2N3OS — CID 25406762
2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 25406762) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 25406762 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CSc2nc3cc(F)c(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C17H15F2N3OS/c1-9-3-4-10(2)13(5-9)20-16(23)8-24-17-21-14-6-11(18)12(19)7-15(14)22-17/h3-7H,8H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | ZDVFRIIVZKEMAD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_65_D(1)', 'substructure': 'N/A'} |
|---|