C15H9BrF2N4O3S — CID 55531798
N-(2-bromo-4-nitrophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 55531798) has the molecular formula C15H9BrF2N4O3S and a molecular weight of 443.23 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 55531798 |
| Molecular Formula | C15H9BrF2N4O3S |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-2-[(5,6-difluoro-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2cc(F)c(F)cc2[nH]1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C15H9BrF2N4O3S/c16-8-3-7(22(24)25)1-2-11(8)19-14(23)6-26-15-20-12-4-9(17)10(18)5-13(12)21-15/h1-5H,6H2,(H,19,23)(H,20,21) |
| InChIKey | KQHOAWNEDFTSHJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_65_D(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|