C10H9BrClN5O3S — CID 15945326
N-(2-bromo-4-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide;hydrochloride (PubChem CID 15945326) has the molecular formula C10H9BrClN5O3S and a molecular weight of 394.64 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide;hydrochloride.
| Compound Name | N-(2-bromo-4-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 15945326 |
| Molecular Formula | C10H9BrClN5O3S |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CSc1ncn[nH]1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C10H8BrN5O3S.ClH/c11-7-3-6(16(18)19)1-2-8(7)14-9(17)4-20-10-12-5-13-15-10;/h1-3,5H,4H2,(H,14,17)(H,12,13,15);1H |
| InChIKey | JUSGUSVXGHKQQN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|