C11H9BrN4O4S — CID 21215154
N-(2-bromo-4-nitrophenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 21215154) has the molecular formula C11H9BrN4O4S and a molecular weight of 373.19 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 21215154 |
| Molecular Formula | C11H9BrN4O4S |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)o1 |
| InChI | InChI=1S/C11H9BrN4O4S/c1-6-14-15-11(20-6)21-5-10(17)13-9-3-2-7(16(18)19)4-8(9)12/h2-4H,5H2,1H3,(H,13,17) |
| InChIKey | MXYBCDYPVSBMHZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|