C14H14Br2N4O4S — CID 55869474
2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide (PubChem CID 55869474) has the molecular formula C14H14Br2N4O4S and a molecular weight of 494.17 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide.
| Compound Name | 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 55869474 |
| Molecular Formula | C14H14Br2N4O4S |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide |
| SMILES | CC(C)(C)c1nnc(SCC(=O)Nc2c(Br)cc([N+](=O)[O-])cc2Br)o1 |
| InChI | InChI=1S/C14H14Br2N4O4S/c1-14(2,3)12-18-19-13(24-12)25-6-10(21)17-11-8(15)4-7(20(22)23)5-9(11)16/h4-5H,6H2,1-3H3,(H,17,21) |
| InChIKey | IDAAOCCXIRTPDS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|