C14H16IN3O2S — CID 55765204
2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide (PubChem CID 55765204) has the molecular formula C14H16IN3O2S and a molecular weight of 417.27 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 55765204 |
| Molecular Formula | C14H16IN3O2S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide |
| SMILES | CC(C)(C)c1nnc(SCC(=O)Nc2ccccc2I)o1 |
| InChI | InChI=1S/C14H16IN3O2S/c1-14(2,3)12-17-18-13(20-12)21-8-11(19)16-10-7-5-4-6-9(10)15/h4-7H,8H2,1-3H3,(H,16,19) |
| InChIKey | TVSSDLDTJWZPCI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|