C15H10ClIN2O2S — CID 4257227
2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide (PubChem CID 4257227) has the molecular formula C15H10ClIN2O2S and a molecular weight of 444.68 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 4257227 |
| Molecular Formula | C15H10ClIN2O2S |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 443.92 |
| IUPAC Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-iodophenyl)acetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2o1)Nc1ccccc1I |
| InChI | InChI=1S/C15H10ClIN2O2S/c16-9-5-6-13-12(7-9)19-15(21-13)22-8-14(20)18-11-4-2-1-3-10(11)17/h1-7H,8H2,(H,18,20) |
| InChIKey | KVHNHFBQRUIENX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|