C22H19N3O4S — CID 55764742
2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 55764742) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 55764742 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | CC(C)(C)c1nnc(SCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)o1 |
| InChI | InChI=1S/C22H19N3O4S/c1-22(2,3)20-24-25-21(29-20)30-11-16(26)23-15-10-6-9-14-17(15)19(28)13-8-5-4-7-12(13)18(14)27/h4-10H,11H2,1-3H3,(H,23,26) |
| InChIKey | NQHQZGDKWWXEJM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|