C20H14N4O4S — CID 135514872
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 135514872) has the molecular formula C20H14N4O4S and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 135514872 |
| Molecular Formula | C20H14N4O4S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C20H14N4O4S/c21-14-8-15(25)24-20(23-14)29-9-16(26)22-13-7-3-6-12-17(13)19(28)11-5-2-1-4-10(11)18(12)27/h1-8H,9H2,(H,22,26)(H3,21,23,24,25) |
| InChIKey | OUXVEGYHMLSBLI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|