C12H7Br5N4O2S — CID 135460097
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4,5,6-pentabromophenyl)acetamide (PubChem CID 135460097) has the molecular formula C12H7Br5N4O2S and a molecular weight of 670.80 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4,5,6-pentabromophenyl)acetamide.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4,5,6-pentabromophenyl)acetamide |
|---|---|
| PubChem CID | 135460097 |
| Molecular Formula | C12H7Br5N4O2S |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 665.62 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4,5,6-pentabromophenyl)acetamide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)Nc2c(Br)c(Br)c(Br)c(Br)c2Br)n1 |
| InChI | InChI=1S/C12H7Br5N4O2S/c13-6-7(14)9(16)11(10(17)8(6)15)20-5(23)2-24-12-19-3(18)1-4(22)21-12/h1H,2H2,(H,20,23)(H3,18,19,21,22) |
| InChIKey | WYJJIRDADWXNMH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|