C13H12BrN5O3S — CID 135496660
N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]-4-bromobenzohydrazide (PubChem CID 135496660) has the molecular formula C13H12BrN5O3S and a molecular weight of 398.24 g/mol. Its IUPAC name is N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]-4-bromobenzohydrazide.
| Compound Name | N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 135496660 |
| Molecular Formula | C13H12BrN5O3S |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]-4-bromobenzohydrazide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)NNC(=O)c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C13H12BrN5O3S/c14-8-3-1-7(2-4-8)12(22)19-18-11(21)6-23-13-16-9(15)5-10(20)17-13/h1-5H,6H2,(H,18,21)(H,19,22)(H3,15,16,17,20) |
| InChIKey | JPQXNDXXKNDUQJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|