C14H12BrN7O3S — CID 135429269
N'-[2-[(5-amino-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]-4-bromobenzohydrazide (PubChem CID 135429269) has the molecular formula C14H12BrN7O3S and a molecular weight of 438.27 g/mol. Its IUPAC name is N'-[2-[(5-amino-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]-4-bromobenzohydrazide.
| Compound Name | N'-[2-[(5-amino-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 135429269 |
| Molecular Formula | C14H12BrN7O3S |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | N'-[2-[(5-amino-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetyl]-4-bromobenzohydrazide |
| SMILES | Nc1cc(=O)[nH]c2nnc(SCC(=O)NNC(=O)c3ccc(Br)cc3)n12 |
| InChI | InChI=1S/C14H12BrN7O3S/c15-8-3-1-7(2-4-8)12(25)19-18-11(24)6-26-14-21-20-13-17-10(23)5-9(16)22(13)14/h1-5H,6,16H2,(H,18,24)(H,19,25)(H,17,20,23) |
| InChIKey | NSRANTHXVXLEON-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|