C16H20BrN5O3S — CID 171983448
4-bromo-N'-[2-[[4-(3-methoxypropyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 171983448) has the molecular formula C16H20BrN5O3S and a molecular weight of 442.34 g/mol. Its IUPAC name is 4-bromo-N'-[2-[[4-(3-methoxypropyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-[[4-(3-methoxypropyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 171983448 |
| Molecular Formula | C16H20BrN5O3S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 4-bromo-N'-[2-[[4-(3-methoxypropyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | COCCCn1c(C)nnc1SCC(=O)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H20BrN5O3S/c1-11-18-21-16(22(11)8-3-9-25-2)26-10-14(23)19-20-15(24)12-4-6-13(17)7-5-12/h4-7H,3,8-10H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | HYAOUAUBKSOCAG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|