C20H31N6O2S+ — CID 7252748
[(1R)-1-[5-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-4-butyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium (PubChem CID 7252748) has the molecular formula C20H31N6O2S+ and a molecular weight of 419.58 g/mol. Its IUPAC name is [(1R)-1-[5-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-4-butyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium.
| Compound Name | [(1R)-1-[5-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-4-butyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 7252748 |
| Molecular Formula | C20H31N6O2S+ |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [(1R)-1-[5-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-4-butyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium |
| SMILES | CCCCn1c(SCC(=O)NNC(=O)c2ccccc2)nnc1[C@@H](CC)[NH+](C)C |
| InChI | InChI=1S/C20H30N6O2S/c1-5-7-13-26-18(16(6-2)25(3)4)22-24-20(26)29-14-17(27)21-23-19(28)15-11-9-8-10-12-15/h8-12,16H,5-7,13-14H2,1-4H3,(H,21,27)(H,23,28)/p+1/t16-/m1/s1 |
| InChIKey | RLAHXVAOSLAZEK-MRXNPFEDSA-O |
| XLogP | 1.23 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|