C23H28ClN6O2S+ — CID 2668780
[(1S)-1-[4-benzyl-5-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium (PubChem CID 2668780) has the molecular formula C23H28ClN6O2S+ and a molecular weight of 488.04 g/mol. Its IUPAC name is [(1S)-1-[4-benzyl-5-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium.
| Compound Name | [(1S)-1-[4-benzyl-5-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 2668780 |
| Molecular Formula | C23H28ClN6O2S+ |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [(1S)-1-[4-benzyl-5-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-dimethylazanium |
| SMILES | CC[C@@H](c1nnc(SCC(=O)NNC(=O)c2ccc(Cl)cc2)n1Cc1ccccc1)[NH+](C)C |
| InChI | InChI=1S/C23H27ClN6O2S/c1-4-19(29(2)3)21-26-28-23(30(21)14-16-8-6-5-7-9-16)33-15-20(31)25-27-22(32)17-10-12-18(24)13-11-17/h5-13,19H,4,14-15H2,1-3H3,(H,25,31)(H,27,32)/p+1/t19-/m0/s1 |
| InChIKey | ZJFPXYXPJZBXQV-IBGZPJMESA-O |
| XLogP | 2.13 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|