C13H14ClN5O2S — CID 864298
4-chloro-N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 864298) has the molecular formula C13H14ClN5O2S and a molecular weight of 339.81 g/mol. Its IUPAC name is 4-chloro-N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 864298 |
| Molecular Formula | C13H14ClN5O2S |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-chloro-N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1nnc(SCC(=O)NNC(=O)c2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C13H14ClN5O2S/c1-8-15-18-13(19(8)2)22-7-11(20)16-17-12(21)9-3-5-10(14)6-4-9/h3-6H,7H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | SPRJZVVWCLPYER-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|