C21H21BrClN5O3S — CID 16502336
4-bromo-N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 16502336) has the molecular formula C21H21BrClN5O3S and a molecular weight of 538.86 g/mol. Its IUPAC name is 4-bromo-N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 16502336 |
| Molecular Formula | C21H21BrClN5O3S |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | 4-bromo-N'-[2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | COCCCn1c(SCC(=O)NNC(=O)c2ccc(Br)cc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21BrClN5O3S/c1-31-12-2-11-28-19(14-5-9-17(23)10-6-14)25-27-21(28)32-13-18(29)24-26-20(30)15-3-7-16(22)8-4-15/h3-10H,2,11-13H2,1H3,(H,24,29)(H,26,30) |
| InChIKey | KSGGMZVSIICIPE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|